C18H23N3O4S2 — CID 2002822
ethyl (2R)-2-[[(12S)-3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-3-oxobutanoate (PubChem CID 2002822) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl (2R)-2-[[(12S)-3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-[[(12S)-3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 2002822 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | ethyl (2R)-2-[[(12S)-3-amino-12-ethyl-12-methyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)[C@H](Sc1nc(N)c2c3c(sc2n1)CO[C@@](C)(CC)C3)C(C)=O |
| InChI | InChI=1S/C18H23N3O4S2/c1-5-18(4)7-10-11(8-25-18)26-15-12(10)14(19)20-17(21-15)27-13(9(3)22)16(23)24-6-2/h13H,5-8H2,1-4H3,(H2,19,20,21)/t13-,18+/m1/s1 |
| InChIKey | GNJHQNOXQGXBGD-ACJLOTCBSA-N |
| XLogP | 3.13 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|