C22H23NO4 — CID 2003412
methyl (3S,4R)-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxo-4-phenylpiperidine-3-carboxylate (PubChem CID 2003412) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is methyl (3S,4R)-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxo-4-phenylpiperidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxo-4-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 2003412 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | methyl (3S,4R)-5,5-dimethyl-1-(4-methylphenyl)-2,6-dioxo-4-phenylpiperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)N(c2ccc(C)cc2)C(=O)C(C)(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H23NO4/c1-14-10-12-16(13-11-14)23-19(24)17(20(25)27-4)18(22(2,3)21(23)26)15-8-6-5-7-9-15/h5-13,17-18H,1-4H3/t17-,18-/m0/s1 |
| InChIKey | ZKYOYCYGDVVOIA-ROUUACIJSA-N |
| XLogP | 3.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|