C24H30N4O3S2 — CID 2003464
N,N-dimethyl-3-[3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 2003464) has the molecular formula C24H30N4O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2003464 |
| Molecular Formula | C24H30N4O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N,N-dimethyl-3-[3-(3-morpholin-4-ylpropyl)-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(-c2cs/c(=N\c3ccccc3)n2CCCN2CCOCC2)c1 |
| InChI | InChI=1S/C24H30N4O3S2/c1-26(2)33(29,30)22-11-6-8-20(18-22)23-19-32-24(25-21-9-4-3-5-10-21)28(23)13-7-12-27-14-16-31-17-15-27/h3-6,8-11,18-19H,7,12-17H2,1-2H3/b25-24- |
| InChIKey | YSDYEFMJTGQKQV-IZHYLOQSSA-N |
| XLogP | 3.42 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|