C21H19N3O4 — CID 2004183
benzyl (5S)-7-(4-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-3-ene-3-carboxylate (PubChem CID 2004183) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is benzyl (5S)-7-(4-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-3-ene-3-carboxylate.
| Compound Name | benzyl (5S)-7-(4-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-3-ene-3-carboxylate |
|---|---|
| PubChem CID | 2004183 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | benzyl (5S)-7-(4-methylphenyl)-6,8-dioxo-1,2,7-triazaspiro[4.4]non-3-ene-3-carboxylate |
| SMILES | Cc1ccc(N2C(=O)C[C@]3(C=C(C(=O)OCc4ccccc4)NN3)C2=O)cc1 |
| InChI | InChI=1S/C21H19N3O4/c1-14-7-9-16(10-8-14)24-18(25)12-21(20(24)27)11-17(22-23-21)19(26)28-13-15-5-3-2-4-6-15/h2-11,22-23H,12-13H2,1H3/t21-/m1/s1 |
| InChIKey | QDJLKHCQRQWJCQ-OAQYLSRUSA-N |
| XLogP | 1.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|