About N-Octylurea
N-Octylurea (PubChem CID 200490) has the molecular formula C9H20N2O
and a molecular weight of 172.27 g/mol. Its IUPAC name is octylurea.
Molecular Properties
| Compound Name | N-Octylurea |
| PubChem CID | 200490 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | octylurea |
| SMILES | CCCCCCCCNC(=O)N |
| InChI | InChI=1S/C9H20N2O/c1-2-3-4-5-6-7-8-11-9(10)12/h2-8H2,1H3,(H3,10,11,12) |
| InChIKey | UBBIDOUCHSVOFY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | 115 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-Octylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-Octylurea?
The IUPAC name of N-Octylurea (CID 200490) is octylurea.
What is the SMILES notation for N-Octylurea?
The canonical SMILES for N-Octylurea is CCCCCCCCNC(=O)N.
What is the InChIKey of N-Octylurea?
The InChIKey is UBBIDOUCHSVOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O/c1-2-3-4-5-6-7-8-11-9(10)12/h2-8H2,1H3,(H3,10,11,12).
What are the key properties of N-Octylurea?
N-Octylurea has a molecular weight of 172.27 g/mol, XLogP of 2.40, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-Octylurea is sourced from PubChem (CID 200490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).