About 6-acetamidohexanoic acid
6-acetamidohexanoic acid (PubChem CID 2005) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 6-acetamidohexanoic acid.
Molecular Properties
| Compound Name | 6-acetamidohexanoic acid |
| PubChem CID | 2005 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 6-acetamidohexanoic acid |
| SMILES | CC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-7(10)9-6-4-2-3-5-8(11)12/h2-6H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | WDSCBUNMANHPFH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-acetamidohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetamidohexanoic acid?
The IUPAC name of 6-acetamidohexanoic acid (CID 2005) is 6-acetamidohexanoic acid.
What is the SMILES notation for 6-acetamidohexanoic acid?
The canonical SMILES for 6-acetamidohexanoic acid is CC(=O)NCCCCCC(=O)O.
What is the InChIKey of 6-acetamidohexanoic acid?
The InChIKey is WDSCBUNMANHPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-7(10)9-6-4-2-3-5-8(11)12/h2-6H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 6-acetamidohexanoic acid?
6-acetamidohexanoic acid has a molecular weight of 173.21 g/mol, XLogP of 0.77, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetamidohexanoic acid is sourced from PubChem (CID 2005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).