C27H27N5O3 — CID 2005197
N-(5-cyano-11-methyl-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-2-ethoxybenzamide (PubChem CID 2005197) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-(5-cyano-11-methyl-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-2-ethoxybenzamide.
| Compound Name | N-(5-cyano-11-methyl-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-2-ethoxybenzamide |
|---|---|
| PubChem CID | 2005197 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-(5-cyano-11-methyl-2-oxo-7-pentyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-6-ylidene)-2-ethoxybenzamide |
| SMILES | CCCCCn1/c(=N/C(=O)c2ccccc2OCC)c(C#N)cc2c(=O)n3cccc(C)c3nc21 |
| InChI | InChI=1S/C27H27N5O3/c1-4-6-9-14-31-24(30-26(33)20-12-7-8-13-22(20)35-5-2)19(17-28)16-21-25(31)29-23-18(3)11-10-15-32(23)27(21)34/h7-8,10-13,15-16H,4-6,9,14H2,1-3H3/b30-24+ |
| InChIKey | NEUROGNGJRIIEB-BGABXYSRSA-N |
| XLogP | 4.16 |
| TPSA | 101.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|