About 1,4-Dibenzylpiperazine
1,4-Dibenzylpiperazine (PubChem CID 200601) has the molecular formula C18H22N2
and a molecular weight of 266.40 g/mol. Its IUPAC name is 1,4-dibenzylpiperazine.
Molecular Properties
| Compound Name | 1,4-Dibenzylpiperazine |
| PubChem CID | 200601 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1,4-dibenzylpiperazine |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)CC3=CC=CC=C3 |
| InChI | InChI=1S/C18H22N2/c1-3-7-17(8-4-1)15-19-11-13-20(14-12-19)16-18-9-5-2-6-10-18/h1-10H,11-16H2 |
| InChIKey | YPUGLZQRXQQCSX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 6.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 231 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-Dibenzylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-Dibenzylpiperazine?
The IUPAC name of 1,4-Dibenzylpiperazine (CID 200601) is 1,4-dibenzylpiperazine.
What is the SMILES notation for 1,4-Dibenzylpiperazine?
The canonical SMILES for 1,4-Dibenzylpiperazine is C1CN(CCN1CC2=CC=CC=C2)CC3=CC=CC=C3.
What is the InChIKey of 1,4-Dibenzylpiperazine?
The InChIKey is YPUGLZQRXQQCSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2/c1-3-7-17(8-4-1)15-19-11-13-20(14-12-19)16-18-9-5-2-6-10-18/h1-10H,11-16H2.
What are the key properties of 1,4-Dibenzylpiperazine?
1,4-Dibenzylpiperazine has a molecular weight of 266.40 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-Dibenzylpiperazine is sourced from PubChem (CID 200601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).