C15H19N5O2 — CID 2006404
2-methoxy-N-[(5S,7R)-5-methyl-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide (PubChem CID 2006404) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-methoxy-N-[(5S,7R)-5-methyl-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide.
| Compound Name | 2-methoxy-N-[(5S,7R)-5-methyl-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 2006404 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-methoxy-N-[(5S,7R)-5-methyl-7-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide |
| SMILES | COCC(=O)Nc1nc2n(n1)[C@@H](c1ccccc1)C[C@H](C)N2 |
| InChI | InChI=1S/C15H19N5O2/c1-10-8-12(11-6-4-3-5-7-11)20-15(16-10)18-14(19-20)17-13(21)9-22-2/h3-7,10,12H,8-9H2,1-2H3,(H2,16,17,18,19,21)/t10-,12+/m0/s1 |
| InChIKey | GFVGPYKCRJWINW-CMPLNLGQSA-N |
| XLogP | 1.66 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |