C29H32N2O+2 — CID 2007912
9-[4-[(1R,2S)-1-methyl-2-(1-methylpyridin-1-ium-3-yl)piperidin-1-ium-1-yl]but-2-ynyl]fluoren-9-ol (PubChem CID 2007912) has the molecular formula C29H32N2O+2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 9-[4-[(1R,2S)-1-methyl-2-(1-methylpyridin-1-ium-3-yl)piperidin-1-ium-1-yl]but-2-ynyl]fluoren-9-ol.
| Compound Name | 9-[4-[(1R,2S)-1-methyl-2-(1-methylpyridin-1-ium-3-yl)piperidin-1-ium-1-yl]but-2-ynyl]fluoren-9-ol |
|---|---|
| PubChem CID | 2007912 |
| Molecular Formula | C29H32N2O+2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 9-[4-[(1R,2S)-1-methyl-2-(1-methylpyridin-1-ium-3-yl)piperidin-1-ium-1-yl]but-2-ynyl]fluoren-9-ol |
| SMILES | C[n+]1cccc([C@@H]2CCCC[N@+]2(C)CC#CCC2(O)c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C29H32N2O/c1-30-19-11-12-23(22-30)28-17-7-9-20-31(28,2)21-10-8-18-29(32)26-15-5-3-13-24(26)25-14-4-6-16-27(25)29/h3-6,11-16,19,22,28,32H,7,9,17-18,20-21H2,1-2H3/q+2/t28-,31+/m0/s1 |
| InChIKey | GKZNKWCBZHJMBQ-QCENPCRXSA-N |
| XLogP | 4.49 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|