C21H18N6O — CID 2009035
10-(3,4-dimethylphenyl)-4-(4-methoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 2009035) has the molecular formula C21H18N6O and a molecular weight of 370.42 g/mol. Its IUPAC name is 10-(3,4-dimethylphenyl)-4-(4-methoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-(3,4-dimethylphenyl)-4-(4-methoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 2009035 |
| Molecular Formula | C21H18N6O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 10-(3,4-dimethylphenyl)-4-(4-methoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | COc1ccc(-c2nc3c4cnn(-c5ccc(C)c(C)c5)c4ncn3n2)cc1 |
| InChI | InChI=1S/C21H18N6O/c1-13-4-7-16(10-14(13)2)27-20-18(11-23-27)21-24-19(25-26(21)12-22-20)15-5-8-17(28-3)9-6-15/h4-12H,1-3H3 |
| InChIKey | YNQBKUWGCBUVFD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |