C25H19ClO7 — CID 2009403
[(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chlorobenzoate (PubChem CID 2009403) has the molecular formula C25H19ClO7 and a molecular weight of 466.87 g/mol. Its IUPAC name is [(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chlorobenzoate.
| Compound Name | [(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2009403 |
| Molecular Formula | C25H19ClO7 |
| Molecular Weight | 466.87 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | [(2Z)-3-oxo-2-[(3,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-chlorobenzoate |
| SMILES | COc1cc(/C=C2\Oc3cc(OC(=O)c4ccccc4Cl)ccc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C25H19ClO7/c1-29-21-11-14(12-22(30-2)24(21)31-3)10-20-23(27)17-9-8-15(13-19(17)33-20)32-25(28)16-6-4-5-7-18(16)26/h4-13H,1-3H3/b20-10- |
| InChIKey | DXATZZFTZPXTJE-JMIUGGIZSA-N |
| XLogP | 5.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.87 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|