C21H30N4O — CID 2010643
2-(4-tert-butylphenyl)-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile (PubChem CID 2010643) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile.
| Compound Name | 2-(4-tert-butylphenyl)-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 2010643 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-[3-(diethylamino)propylamino]-1,3-oxazole-4-carbonitrile |
| SMILES | CCN(CC)CCCNc1oc(-c2ccc(C(C)(C)C)cc2)nc1C#N |
| InChI | InChI=1S/C21H30N4O/c1-6-25(7-2)14-8-13-23-20-18(15-22)24-19(26-20)16-9-11-17(12-10-16)21(3,4)5/h9-12,23H,6-8,13-14H2,1-5H3 |
| InChIKey | JPCPKUQHWOPWHV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|