C20H13F5N2O2 — CID 2011082
1-(3-methylphenyl)-3-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]urea (PubChem CID 2011082) has the molecular formula C20H13F5N2O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]urea |
|---|---|
| PubChem CID | 2011082 |
| Molecular Formula | C20H13F5N2O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-(3-methylphenyl)-3-[3-(2,3,4,5,6-pentafluorophenoxy)phenyl]urea |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(Oc3c(F)c(F)c(F)c(F)c3F)c2)c1 |
| InChI | InChI=1S/C20H13F5N2O2/c1-10-4-2-5-11(8-10)26-20(28)27-12-6-3-7-13(9-12)29-19-17(24)15(22)14(21)16(23)18(19)25/h2-9H,1H3,(H2,26,27,28) |
| InChIKey | IGAOXIOXHAITHC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|