About 2-ethylheptanamide
2-ethylheptanamide (PubChem CID 20126) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-ethylheptanamide.
Molecular Properties
| Compound Name | 2-ethylheptanamide |
| PubChem CID | 20126 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 2-ethylheptanamide |
| SMILES | CCCCCC(CC)C(N)=O |
| InChI | InChI=1S/C9H19NO/c1-3-5-6-7-8(4-2)9(10)11/h8H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | AOFZLQPFVNKHSR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylheptanamide?
The IUPAC name of 2-ethylheptanamide (CID 20126) is 2-ethylheptanamide.
What is the SMILES notation for 2-ethylheptanamide?
The canonical SMILES for 2-ethylheptanamide is CCCCCC(CC)C(N)=O.
What is the InChIKey of 2-ethylheptanamide?
The InChIKey is AOFZLQPFVNKHSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-3-5-6-7-8(4-2)9(10)11/h8H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 2-ethylheptanamide?
2-ethylheptanamide has a molecular weight of 157.26 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylheptanamide is sourced from PubChem (CID 20126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).