About 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine
4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 2012833) has the molecular formula C17H10Cl2N2OS
and a molecular weight of 361.25 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine |
| PubChem CID | 2012833 |
| Molecular Formula | C17H10Cl2N2OS |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Clc1ccc(CSc2ncnc3c2oc2ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl2N2OS/c18-11-6-5-10(13(19)7-11)8-23-17-16-15(20-9-21-17)12-3-1-2-4-14(12)22-16/h1-7,9H,8H2 |
| InChIKey | ZKSHEVPSHGWHEB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine?
The IUPAC name of 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine (CID 2012833) is 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine.
What is the SMILES notation for 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine?
The canonical SMILES for 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine is Clc1ccc(CSc2ncnc3c2oc2ccccc23)c(Cl)c1.
What is the InChIKey of 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine?
The InChIKey is ZKSHEVPSHGWHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2N2OS/c18-11-6-5-10(13(19)7-11)8-23-17-16-15(20-9-21-17)12-3-1-2-4-14(12)22-16/h1-7,9H,8H2.
What are the key properties of 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine?
4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine has a molecular weight of 361.25 g/mol, XLogP of 5.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dichlorophenyl)methylsulfanyl]-[1]benzofuro[3,2-d]pyrimidine is sourced from PubChem (CID 2012833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).