C22H19F3NO3+ — CID 2013226
4-[[3-(trifluoromethyl)phenyl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one (PubChem CID 2013226) has the molecular formula C22H19F3NO3+ and a molecular weight of 402.39 g/mol. Its IUPAC name is 4-[[3-(trifluoromethyl)phenyl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one.
| Compound Name | 4-[[3-(trifluoromethyl)phenyl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one |
|---|---|
| PubChem CID | 2013226 |
| Molecular Formula | C22H19F3NO3+ |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-[[3-(trifluoromethyl)phenyl]methyl]-6,17-dioxa-4-azoniatetracyclo[8.7.0.02,7.011,15]heptadeca-1(10),2(7),8,11(15)-tetraen-16-one |
| SMILES | O=c1oc2c3c(ccc2c2c1CCC2)OC[NH+](Cc1cccc(C(F)(F)F)c1)C3 |
| InChI | InChI=1S/C22H18F3NO3/c23-22(24,25)14-4-1-3-13(9-14)10-26-11-18-19(28-12-26)8-7-16-15-5-2-6-17(15)21(27)29-20(16)18/h1,3-4,7-9H,2,5-6,10-12H2/p+1 |
| InChIKey | OPJCMRCAYLYCLG-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|