C18H24N4O2S2 — CID 2013996
[2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] piperidine-1-carbodithioate (PubChem CID 2013996) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is [2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] piperidine-1-carbodithioate.
| Compound Name | [2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 2013996 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] piperidine-1-carbodithioate |
| SMILES | CC1(C)CC(=O)c2cnc(NC(=O)CSC(=S)N3CCCCC3)nc2C1 |
| InChI | InChI=1S/C18H24N4O2S2/c1-18(2)8-13-12(14(23)9-18)10-19-16(20-13)21-15(24)11-26-17(25)22-6-4-3-5-7-22/h10H,3-9,11H2,1-2H3,(H,19,20,21,24) |
| InChIKey | QWUYURCFRZJBLX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|