About 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol
3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol (PubChem CID 2014689) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol.
Molecular Properties
| Compound Name | 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol |
| PubChem CID | 2014689 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol |
| SMILES | OCCCNc1ncnc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C13H14N4O/c18-7-3-6-14-13-12-11(15-8-16-13)9-4-1-2-5-10(9)17-12/h1-2,4-5,8,17-18H,3,6-7H2,(H,14,15,16) |
| InChIKey | BPWBNFPGYQJRFZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol?
The IUPAC name of 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol (CID 2014689) is 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol.
What is the SMILES notation for 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol?
The canonical SMILES for 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol is OCCCNc1ncnc2c1[nH]c1ccccc12.
What is the InChIKey of 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol?
The InChIKey is BPWBNFPGYQJRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O/c18-7-3-6-14-13-12-11(15-8-16-13)9-4-1-2-5-10(9)17-12/h1-2,4-5,8,17-18H,3,6-7H2,(H,14,15,16).
What are the key properties of 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol?
3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol has a molecular weight of 242.28 g/mol, XLogP of 1.91, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5H-pyrimido[5,4-b]indol-4-ylamino)propan-1-ol is sourced from PubChem (CID 2014689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).