C27H27N5O2 — CID 2015230
2-(4-methoxyphenyl)-N-[(5R,7R)-7-(4-methylphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide (PubChem CID 2015230) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(5R,7R)-7-(4-methylphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[(5R,7R)-7-(4-methylphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 2015230 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(5R,7R)-7-(4-methylphenyl)-5-phenyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nc3n(n2)[C@@H](c2ccc(C)cc2)C[C@H](c2ccccc2)N3)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-18-8-12-21(13-9-18)24-17-23(20-6-4-3-5-7-20)28-27-30-26(31-32(24)27)29-25(33)16-19-10-14-22(34-2)15-11-19/h3-15,23-24H,16-17H2,1-2H3,(H2,28,29,30,31,33)/t23-,24-/m1/s1 |
| InChIKey | LSDNEMYFDMIVOH-DNQXCXABSA-N |
| XLogP | 4.92 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |