About [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate
[2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate (PubChem CID 2015259) has the molecular formula C15H18N4O3S2
and a molecular weight of 366.47 g/mol. Its IUPAC name is [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate.
Molecular Properties
| Compound Name | [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate |
| PubChem CID | 2015259 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCOCC1)Nc1ncc2c(n1)CCCC2=O |
| InChI | InChI=1S/C15H18N4O3S2/c20-12-3-1-2-11-10(12)8-16-14(17-11)18-13(21)9-24-15(23)19-4-6-22-7-5-19/h8H,1-7,9H2,(H,16,17,18,21) |
| InChIKey | LIGPTMMJBOAMPZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate?
The IUPAC name of [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate (CID 2015259) is [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate.
What is the SMILES notation for [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate?
The canonical SMILES for [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate is O=C(CSC(=S)N1CCOCC1)Nc1ncc2c(n1)CCCC2=O.
What is the InChIKey of [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate?
The InChIKey is LIGPTMMJBOAMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O3S2/c20-12-3-1-2-11-10(12)8-16-14(17-11)18-13(21)9-24-15(23)19-4-6-22-7-5-19/h8H,1-7,9H2,(H,16,17,18,21).
What are the key properties of [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate?
[2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate has a molecular weight of 366.47 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[(5-oxo-7,8-dihydro-6H-quinazolin-2-yl)amino]ethyl] morpholine-4-carbodithioate is sourced from PubChem (CID 2015259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).