C27H29N5O — CID 2015263
17-(3,4-dimethylphenyl)-13-hexyl-14-methyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 2015263) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is 17-(3,4-dimethylphenyl)-13-hexyl-14-methyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-(3,4-dimethylphenyl)-13-hexyl-14-methyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 2015263 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 17-(3,4-dimethylphenyl)-13-hexyl-14-methyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | CCCCCCn1c(C)nc2c(c1=O)c1nc3ccccc3nc1n2-c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C27H29N5O/c1-5-6-7-10-15-31-19(4)28-25-23(27(31)33)24-26(30-22-12-9-8-11-21(22)29-24)32(25)20-14-13-17(2)18(3)16-20/h8-9,11-14,16H,5-7,10,15H2,1-4H3 |
| InChIKey | DGWRXMJSFIKLHV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|