C22H24N4O3 — CID 2015821
N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 2015821) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 2015821 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-8-ethoxy-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | CCOc1ccc2[nH]c3c(NCCc4ccc(OC)c(OC)c4)ncnc3c2c1 |
| InChI | InChI=1S/C22H24N4O3/c1-4-29-15-6-7-17-16(12-15)20-21(26-17)22(25-13-24-20)23-10-9-14-5-8-18(27-2)19(11-14)28-3/h5-8,11-13,26H,4,9-10H2,1-3H3,(H,23,24,25) |
| InChIKey | BEIGZMUAVKDCQI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |