C6H10N2 — CID 20164412
1,5-dimethyl-2H-pyrazine (PubChem CID 20164412) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is 1,5-dimethyl-2H-pyrazine.
| Compound Name | 1,5-dimethyl-2H-pyrazine |
|---|---|
| PubChem CID | 20164412 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 1,5-dimethyl-2H-pyrazine |
| SMILES | CC1=CN(CC=N1)C |
| InChI | InChI=1S/C6H10N2/c1-6-5-8(2)4-3-7-6/h3,5H,4H2,1-2H3 |
| InChIKey | DPYRQYAODGUFFH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | 135 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |