About 4-propoxy-5H-pyrimido[5,4-b]indole
4-propoxy-5H-pyrimido[5,4-b]indole (PubChem CID 2018623) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-propoxy-5H-pyrimido[5,4-b]indole.
Molecular Properties
| Compound Name | 4-propoxy-5H-pyrimido[5,4-b]indole |
| PubChem CID | 2018623 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-propoxy-5H-pyrimido[5,4-b]indole |
| SMILES | CCCOc1ncnc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C13H13N3O/c1-2-7-17-13-12-11(14-8-15-13)9-5-3-4-6-10(9)16-12/h3-6,8,16H,2,7H2,1H3 |
| InChIKey | PDNQLXYWZKGTEG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propoxy-5H-pyrimido[5,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propoxy-5H-pyrimido[5,4-b]indole?
The IUPAC name of 4-propoxy-5H-pyrimido[5,4-b]indole (CID 2018623) is 4-propoxy-5H-pyrimido[5,4-b]indole.
What is the SMILES notation for 4-propoxy-5H-pyrimido[5,4-b]indole?
The canonical SMILES for 4-propoxy-5H-pyrimido[5,4-b]indole is CCCOc1ncnc2c1[nH]c1ccccc12.
What is the InChIKey of 4-propoxy-5H-pyrimido[5,4-b]indole?
The InChIKey is PDNQLXYWZKGTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O/c1-2-7-17-13-12-11(14-8-15-13)9-5-3-4-6-10(9)16-12/h3-6,8,16H,2,7H2,1H3.
What are the key properties of 4-propoxy-5H-pyrimido[5,4-b]indole?
4-propoxy-5H-pyrimido[5,4-b]indole has a molecular weight of 227.27 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propoxy-5H-pyrimido[5,4-b]indole is sourced from PubChem (CID 2018623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).