About 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one
2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one (PubChem CID 2019413) has the molecular formula C19H10Cl2O3
and a molecular weight of 357.19 g/mol. Its IUPAC name is 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one.
Molecular Properties
| Compound Name | 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one |
| PubChem CID | 2019413 |
| Molecular Formula | C19H10Cl2O3 |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one |
| SMILES | O=c1cc(-c2ccc(-c3ccc(Cl)c(Cl)c3)o2)oc2ccccc12 |
| InChI | InChI=1S/C19H10Cl2O3/c20-13-6-5-11(9-14(13)21)16-7-8-18(23-16)19-10-15(22)12-3-1-2-4-17(12)24-19/h1-10H |
| InChIKey | IUWXGNDKINNBON-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one?
The IUPAC name of 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one (CID 2019413) is 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one.
What is the SMILES notation for 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one?
The canonical SMILES for 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one is O=c1cc(-c2ccc(-c3ccc(Cl)c(Cl)c3)o2)oc2ccccc12.
What is the InChIKey of 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one?
The InChIKey is IUWXGNDKINNBON-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10Cl2O3/c20-13-6-5-11(9-14(13)21)16-7-8-18(23-16)19-10-15(22)12-3-1-2-4-17(12)24-19/h1-10H.
What are the key properties of 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one?
2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one has a molecular weight of 357.19 g/mol, XLogP of 6.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,4-dichlorophenyl)furan-2-yl]chromen-4-one is sourced from PubChem (CID 2019413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).