C15H24N6O4 — CID 2019642
N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide (PubChem CID 2019642) has the molecular formula C15H24N6O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide.
| Compound Name | N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 2019642 |
| Molecular Formula | C15H24N6O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N-[2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)oxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H24N6O4/c1-12(22)16-2-7-25-15-18-13(20-3-8-23-9-4-20)17-14(19-15)21-5-10-24-11-6-21/h2-11H2,1H3,(H,16,22) |
| InChIKey | JPUNSPFNCDALSY-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|