C19H15N4O2+ — CID 2020528
(2R,3R,10bS)-1,1-dicyano-2-(furan-2-yl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide (PubChem CID 2020528) has the molecular formula C19H15N4O2+ and a molecular weight of 331.36 g/mol. Its IUPAC name is (2R,3R,10bS)-1,1-dicyano-2-(furan-2-yl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide.
| Compound Name | (2R,3R,10bS)-1,1-dicyano-2-(furan-2-yl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 2020528 |
| Molecular Formula | C19H15N4O2+ |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2R,3R,10bS)-1,1-dicyano-2-(furan-2-yl)-2,3,4,10b-tetrahydropyrrolo[2,1-a]isoquinolin-4-ium-3-carboxamide |
| SMILES | N#CC1(C#N)[C@@H]2c3ccccc3C=C[NH+]2[C@@H](C(N)=O)[C@@H]1c1ccco1 |
| InChI | InChI=1S/C19H14N4O2/c20-10-19(11-21)15(14-6-3-9-25-14)16(18(22)24)23-8-7-12-4-1-2-5-13(12)17(19)23/h1-9,15-17H,(H2,22,24)/p+1/t15-,16+,17-/m0/s1 |
| InChIKey | GQBPQIBYXRTVJF-BBWFWOEESA-O |
| XLogP | 0.87 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |