About Benzamide, 2,2'-dithiobis(N-propyl-
Benzamide, 2,2'-dithiobis(N-propyl- (PubChem CID 202209) has the molecular formula C20H24N2O2S2
and a molecular weight of 388.60 g/mol. Its IUPAC name is N-propyl-2-[[2-(propylcarbamoyl)phenyl]disulfanyl]benzamide.
Molecular Properties
| Compound Name | Benzamide, 2,2'-dithiobis(N-propyl- |
| PubChem CID | 202209 |
| Molecular Formula | C20H24N2O2S2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-propyl-2-[[2-(propylcarbamoyl)phenyl]disulfanyl]benzamide |
| SMILES | CCCNC(=O)C1=CC=CC=C1SSC2=CC=CC=C2C(=O)NCCC |
| InChI | InChI=1S/C20H24N2O2S2/c1-3-13-21-19(23)15-9-5-7-11-17(15)25-26-18-12-8-6-10-16(18)20(24)22-14-4-2/h5-12H,3-4,13-14H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | YEGDCKYCFIROQE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | 408 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze Benzamide, 2,2'-dithiobis(N-propyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzamide, 2,2'-dithiobis(N-propyl-?
The IUPAC name of Benzamide, 2,2'-dithiobis(N-propyl- (CID 202209) is N-propyl-2-[[2-(propylcarbamoyl)phenyl]disulfanyl]benzamide.
What is the SMILES notation for Benzamide, 2,2'-dithiobis(N-propyl-?
The canonical SMILES for Benzamide, 2,2'-dithiobis(N-propyl- is CCCNC(=O)C1=CC=CC=C1SSC2=CC=CC=C2C(=O)NCCC.
What is the InChIKey of Benzamide, 2,2'-dithiobis(N-propyl-?
The InChIKey is YEGDCKYCFIROQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2S2/c1-3-13-21-19(23)15-9-5-7-11-17(15)25-26-18-12-8-6-10-16(18)20(24)22-14-4-2/h5-12H,3-4,13-14H2,1-2H3,(H,21,23)(H,22,24).
What are the key properties of Benzamide, 2,2'-dithiobis(N-propyl-?
Benzamide, 2,2'-dithiobis(N-propyl- has a molecular weight of 388.60 g/mol, XLogP of 4.40, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Benzamide, 2,2'-dithiobis(N-propyl- is sourced from PubChem (CID 202209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).