C19H20N4O4S2 — CID 2022143
[2-[[(7S)-7-(furan-2-yl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]amino]-2-oxoethyl] morpholine-4-carbodithioate (PubChem CID 2022143) has the molecular formula C19H20N4O4S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is [2-[[(7S)-7-(furan-2-yl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]amino]-2-oxoethyl] morpholine-4-carbodithioate.
| Compound Name | [2-[[(7S)-7-(furan-2-yl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]amino]-2-oxoethyl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 2022143 |
| Molecular Formula | C19H20N4O4S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [2-[[(7S)-7-(furan-2-yl)-5-oxo-7,8-dihydro-6H-quinazolin-2-yl]amino]-2-oxoethyl] morpholine-4-carbodithioate |
| SMILES | O=C(CSC(=S)N1CCOCC1)Nc1ncc2c(n1)C[C@H](c1ccco1)CC2=O |
| InChI | InChI=1S/C19H20N4O4S2/c24-15-9-12(16-2-1-5-27-16)8-14-13(15)10-20-18(21-14)22-17(25)11-29-19(28)23-3-6-26-7-4-23/h1-2,5,10,12H,3-4,6-9,11H2,(H,20,21,22,25)/t12-/m0/s1 |
| InChIKey | BFANXKFXQACWJZ-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|