C18H17N5O2 — CID 2023523
8-(2,5-dimethylpyrrol-1-yl)-1,3-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 2023523) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 8-(2,5-dimethylpyrrol-1-yl)-1,3-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 8-(2,5-dimethylpyrrol-1-yl)-1,3-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 2023523 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 8-(2,5-dimethylpyrrol-1-yl)-1,3-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1ccc(C)n1-c1ccc2nc3c(=O)n(C)c(=O)n(C)c3nc2c1 |
| InChI | InChI=1S/C18H17N5O2/c1-10-5-6-11(2)23(10)12-7-8-13-14(9-12)20-16-15(19-13)17(24)22(4)18(25)21(16)3/h5-9H,1-4H3 |
| InChIKey | BSQOYIFUHVLHIP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|