About Dichloro vinyl ketone
Dichloro vinyl ketone (PubChem CID 20236245) has the molecular formula C5H2Cl4O
and a molecular weight of 219.90 g/mol. Its IUPAC name is (1Z,4Z)-1,2,4,5-tetrachloropenta-1,4-dien-3-one.
Molecular Properties
| Compound Name | Dichloro vinyl ketone |
| PubChem CID | 20236245 |
| Molecular Formula | C5H2Cl4O |
| Molecular Weight | 219.90 g/mol |
| Exact Mass | 219.88 |
| IUPAC Name | (1Z,4Z)-1,2,4,5-tetrachloropenta-1,4-dien-3-one |
| SMILES | C(=C(\Cl)/C(=O)/C(=C/Cl)/Cl)\Cl |
| InChI | InChI=1S/C5H2Cl4O/c6-1-3(8)5(10)4(9)2-7/h1-2H/b3-1-,4-2- |
| InChIKey | CSIIWMPQOKLEMP-CCAGOZQPSA-N |
| XLogP | 3.40 |
| TPSA | 17.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | 174 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.90 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Dichloro vinyl ketone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dichloro vinyl ketone?
The IUPAC name of Dichloro vinyl ketone (CID 20236245) is (1Z,4Z)-1,2,4,5-tetrachloropenta-1,4-dien-3-one.
What is the SMILES notation for Dichloro vinyl ketone?
The canonical SMILES for Dichloro vinyl ketone is C(=C(\Cl)/C(=O)/C(=C/Cl)/Cl)\Cl.
What is the InChIKey of Dichloro vinyl ketone?
The InChIKey is CSIIWMPQOKLEMP-CCAGOZQPSA-N. The full InChI is InChI=1S/C5H2Cl4O/c6-1-3(8)5(10)4(9)2-7/h1-2H/b3-1-,4-2-.
What are the key properties of Dichloro vinyl ketone?
Dichloro vinyl ketone has a molecular weight of 219.90 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Dichloro vinyl ketone is sourced from PubChem (CID 20236245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).