C20H23N5O3S — CID 2024389
1-ethyl-3-[2-[2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]indol-3-yl]ethyl]thiourea (PubChem CID 2024389) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-[2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]indol-3-yl]ethyl]thiourea.
| Compound Name | 1-ethyl-3-[2-[2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]indol-3-yl]ethyl]thiourea |
|---|---|
| PubChem CID | 2024389 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 1-ethyl-3-[2-[2-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]indol-3-yl]ethyl]thiourea |
| SMILES | CCNC(=S)NCCC1=c2ccccc2=NC1=Cc1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C20H23N5O3S/c1-4-21-19(29)22-10-9-13-12-7-5-6-8-15(12)23-16(13)11-14-17(26)24(2)20(28)25(3)18(14)27/h5-8,11,26H,4,9-10H2,1-3H3,(H2,21,22,29) |
| InChIKey | RVDGZTHDZMDUCR-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|