About 9-methylsulfonyloxynonyl methanesulfonate
9-methylsulfonyloxynonyl methanesulfonate (PubChem CID 20244) has the molecular formula C11H24O6S2
and a molecular weight of 316.44 g/mol. Its IUPAC name is 9-methylsulfonyloxynonyl methanesulfonate.
Molecular Properties
| Compound Name | 9-methylsulfonyloxynonyl methanesulfonate |
| PubChem CID | 20244 |
| Molecular Formula | C11H24O6S2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 9-methylsulfonyloxynonyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCCCCCCCOS(C)(=O)=O |
| InChI | InChI=1S/C11H24O6S2/c1-18(12,13)16-10-8-6-4-3-5-7-9-11-17-19(2,14)15/h3-11H2,1-2H3 |
| InChIKey | NIYYZZQGQRDTGO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 9-methylsulfonyloxynonyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylsulfonyloxynonyl methanesulfonate?
The IUPAC name of 9-methylsulfonyloxynonyl methanesulfonate (CID 20244) is 9-methylsulfonyloxynonyl methanesulfonate.
What is the SMILES notation for 9-methylsulfonyloxynonyl methanesulfonate?
The canonical SMILES for 9-methylsulfonyloxynonyl methanesulfonate is CS(=O)(=O)OCCCCCCCCCOS(C)(=O)=O.
What is the InChIKey of 9-methylsulfonyloxynonyl methanesulfonate?
The InChIKey is NIYYZZQGQRDTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O6S2/c1-18(12,13)16-10-8-6-4-3-5-7-9-11-17-19(2,14)15/h3-11H2,1-2H3.
What are the key properties of 9-methylsulfonyloxynonyl methanesulfonate?
9-methylsulfonyloxynonyl methanesulfonate has a molecular weight of 316.44 g/mol, XLogP of 1.67, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylsulfonyloxynonyl methanesulfonate is sourced from PubChem (CID 20244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).