About 1-propylsulfinylpropane
1-propylsulfinylpropane (PubChem CID 20252) has the molecular formula C6H14OS
and a molecular weight of 134.24 g/mol. Its IUPAC name is 1-propylsulfinylpropane.
Molecular Properties
| Compound Name | 1-propylsulfinylpropane |
| PubChem CID | 20252 |
| Molecular Formula | C6H14OS |
| Molecular Weight | 134.24 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1-propylsulfinylpropane |
| SMILES | CCCS(=O)CCC |
| InChI | InChI=1S/C6H14OS/c1-3-5-8(7)6-4-2/h3-6H2,1-2H3 |
| InChIKey | BQCCJWMQESHLIT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propylsulfinylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylsulfinylpropane?
The IUPAC name of 1-propylsulfinylpropane (CID 20252) is 1-propylsulfinylpropane.
What is the SMILES notation for 1-propylsulfinylpropane?
The canonical SMILES for 1-propylsulfinylpropane is CCCS(=O)CCC.
What is the InChIKey of 1-propylsulfinylpropane?
The InChIKey is BQCCJWMQESHLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14OS/c1-3-5-8(7)6-4-2/h3-6H2,1-2H3.
What are the key properties of 1-propylsulfinylpropane?
1-propylsulfinylpropane has a molecular weight of 134.24 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylsulfinylpropane is sourced from PubChem (CID 20252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).