About 9-benzylpurin-6-amine
9-benzylpurin-6-amine (PubChem CID 20262) has the molecular formula C12H11N5
and a molecular weight of 225.26 g/mol. Its IUPAC name is 9-benzylpurin-6-amine.
Molecular Properties
| Compound Name | 9-benzylpurin-6-amine |
| PubChem CID | 20262 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 9-benzylpurin-6-amine |
| SMILES | Nc1ncnc2c1ncn2Cc1ccccc1 |
| InChI | InChI=1S/C12H11N5/c13-11-10-12(15-7-14-11)17(8-16-10)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H2,13,14,15) |
| InChIKey | MRHCSNNEUHXNIC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-benzylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzylpurin-6-amine?
The IUPAC name of 9-benzylpurin-6-amine (CID 20262) is 9-benzylpurin-6-amine.
What is the SMILES notation for 9-benzylpurin-6-amine?
The canonical SMILES for 9-benzylpurin-6-amine is Nc1ncnc2c1ncn2Cc1ccccc1.
What is the InChIKey of 9-benzylpurin-6-amine?
The InChIKey is MRHCSNNEUHXNIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5/c13-11-10-12(15-7-14-11)17(8-16-10)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H2,13,14,15).
What are the key properties of 9-benzylpurin-6-amine?
9-benzylpurin-6-amine has a molecular weight of 225.26 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzylpurin-6-amine is sourced from PubChem (CID 20262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).