About N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine
N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 2026875) has the molecular formula C23H19FN4O
and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine.
Molecular Properties
| Compound Name | N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine |
| PubChem CID | 2026875 |
| Molecular Formula | C23H19FN4O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | Fc1ccc([C@H](CCNc2ncnc3c2[nH]c2ccccc23)c2ccco2)cc1 |
| InChI | InChI=1S/C23H19FN4O/c24-16-9-7-15(8-10-16)17(20-6-3-13-29-20)11-12-25-23-22-21(26-14-27-23)18-4-1-2-5-19(18)28-22/h1-10,13-14,17,28H,11-12H2,(H,25,26,27)/t17-/m0/s1 |
| InChIKey | STNXDKSUVRJLFH-KRWDZBQOSA-N |
| XLogP | 5.48 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine?
The IUPAC name of N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine (CID 2026875) is N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine.
What is the SMILES notation for N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine?
The canonical SMILES for N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine is Fc1ccc([C@H](CCNc2ncnc3c2[nH]c2ccccc23)c2ccco2)cc1.
What is the InChIKey of N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine?
The InChIKey is STNXDKSUVRJLFH-KRWDZBQOSA-N. The full InChI is InChI=1S/C23H19FN4O/c24-16-9-7-15(8-10-16)17(20-6-3-13-29-20)11-12-25-23-22-21(26-14-27-23)18-4-1-2-5-19(18)28-22/h1-10,13-14,17,28H,11-12H2,(H,25,26,27)/t17-/m0/s1.
What are the key properties of N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine?
N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine has a molecular weight of 386.43 g/mol, XLogP of 5.48, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3-(4-fluorophenyl)-3-(furan-2-yl)propyl]-5H-pyrimido[5,4-b]indol-4-amine is sourced from PubChem (CID 2026875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).