C22H21ClN2O2 — CID 2026970
5-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)furan-2-carboxamide (PubChem CID 2026970) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 2026970 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C22H21ClN2O2/c23-17-10-8-16(9-11-17)20-12-13-21(27-20)22(26)24-18-6-2-3-7-19(18)25-14-4-1-5-15-25/h2-3,6-13H,1,4-5,14-15H2,(H,24,26) |
| InChIKey | KSJMFXRFOAAIJJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |