About 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline
1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 2027650) has the molecular formula C17H12ClN3
and a molecular weight of 293.76 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline |
| PubChem CID | 2027650 |
| Molecular Formula | C17H12ClN3 |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | Cc1cc2nnc(-c3ccc(Cl)cc3)n2c2ccccc12 |
| InChI | InChI=1S/C17H12ClN3/c1-11-10-16-19-20-17(12-6-8-13(18)9-7-12)21(16)15-5-3-2-4-14(11)15/h2-10H,1H3 |
| InChIKey | BQTRBGJBUQHVPO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
The IUPAC name of 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline (CID 2027650) is 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline.
What is the SMILES notation for 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
The canonical SMILES for 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline is Cc1cc2nnc(-c3ccc(Cl)cc3)n2c2ccccc12.
What is the InChIKey of 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
The InChIKey is BQTRBGJBUQHVPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClN3/c1-11-10-16-19-20-17(12-6-8-13(18)9-7-12)21(16)15-5-3-2-4-14(11)15/h2-10H,1H3.
What are the key properties of 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline has a molecular weight of 293.76 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-5-methyl-[1,2,4]triazolo[4,3-a]quinoline is sourced from PubChem (CID 2027650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).