C18H21N5O — CID 2027973
11-[(4-propan-2-ylphenyl)methylamino]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 2027973) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 11-[(4-propan-2-ylphenyl)methylamino]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 11-[(4-propan-2-ylphenyl)methylamino]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 2027973 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 11-[(4-propan-2-ylphenyl)methylamino]-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | CC(C)c1ccc(CNc2nc3nc4c(c(=O)n3[nH]2)CCC4)cc1 |
| InChI | InChI=1S/C18H21N5O/c1-11(2)13-8-6-12(7-9-13)10-19-17-21-18-20-15-5-3-4-14(15)16(24)23(18)22-17/h6-9,11H,3-5,10H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | WLHDEGQCMDHBMN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |