C22H28N3S+ — CID 2028134
5-cycloheptyl-1,3-diphenyl-1,3,5-triazinan-5-ium-2-thione (PubChem CID 2028134) has the molecular formula C22H28N3S+ and a molecular weight of 366.55 g/mol. Its IUPAC name is 5-cycloheptyl-1,3-diphenyl-1,3,5-triazinan-5-ium-2-thione.
| Compound Name | 5-cycloheptyl-1,3-diphenyl-1,3,5-triazinan-5-ium-2-thione |
|---|---|
| PubChem CID | 2028134 |
| Molecular Formula | C22H28N3S+ |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 5-cycloheptyl-1,3-diphenyl-1,3,5-triazinan-5-ium-2-thione |
| SMILES | S=C1N(c2ccccc2)C[NH+](C2CCCCCC2)CN1c1ccccc1 |
| InChI | InChI=1S/C22H27N3S/c26-22-24(20-13-7-3-8-14-20)17-23(19-11-5-1-2-6-12-19)18-25(22)21-15-9-4-10-16-21/h3-4,7-10,13-16,19H,1-2,5-6,11-12,17-18H2/p+1 |
| InChIKey | QMFFCUREJKJKPC-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 10.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|