C14H14N5S+ — CID 2028427
(4R)-4-(3-methylthiophen-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine (PubChem CID 2028427) has the molecular formula C14H14N5S+ and a molecular weight of 284.37 g/mol. Its IUPAC name is (4R)-4-(3-methylthiophen-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine.
| Compound Name | (4R)-4-(3-methylthiophen-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
|---|---|
| PubChem CID | 2028427 |
| Molecular Formula | C14H14N5S+ |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4R)-4-(3-methylthiophen-2-yl)-4,10-dihydro-1H-[1,3,5]triazino[1,2-a]benzimidazol-5-ium-2-amine |
| SMILES | Cc1ccsc1[C@@H]1N=C(N)Nc2[nH]c3ccccc3[n+]21 |
| InChI | InChI=1S/C14H13N5S/c1-8-6-7-20-11(8)12-17-13(15)18-14-16-9-4-2-3-5-10(9)19(12)14/h2-7,12H,1H3,(H3,15,16,17,18)/p+1/t12-/m1/s1 |
| InChIKey | OTNYPQCJSZPQSL-GFCCVEGCSA-O |
| XLogP | 2.11 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|