C23H40NO2+ — CID 2028697
[(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-methylpentyl]-[(4-propan-2-yloxyphenyl)methyl]azanium (PubChem CID 2028697) has the molecular formula C23H40NO2+ and a molecular weight of 362.58 g/mol. Its IUPAC name is [(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-methylpentyl]-[(4-propan-2-yloxyphenyl)methyl]azanium.
| Compound Name | [(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-methylpentyl]-[(4-propan-2-yloxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 2028697 |
| Molecular Formula | C23H40NO2+ |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.31 |
| IUPAC Name | [(3R)-3-[(4S)-2,2-dimethyloxan-4-yl]-4-methylpentyl]-[(4-propan-2-yloxyphenyl)methyl]azanium |
| SMILES | CC(C)Oc1ccc(C[NH2+]CC[C@H](C(C)C)[C@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C23H39NO2/c1-17(2)22(20-12-14-25-23(5,6)15-20)11-13-24-16-19-7-9-21(10-8-19)26-18(3)4/h7-10,17-18,20,22,24H,11-16H2,1-6H3/p+1/t20-,22+/m0/s1 |
| InChIKey | XSQWQHCMNCZHKU-RBBKRZOGSA-O |
| XLogP | 4.40 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|