2-fluoroethyl 2-(4-phenylphenyl)acetate

C16H15FO2 — CID 20288

IUPAC2-fluoroethyl 2-(4-phenylphenyl)acetate
SMILESO=C(Cc1ccc(-c2ccccc2)cc1)OCCF
InChIInChI=1S/C16H15FO2/c17-10-11-19-16(18)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9H,10-12H2
InChIKeyXAERLJMOUYEBAB-UHFFFAOYSA-N
MW258.29 g/mol
LogP3.41
Rot. Bonds5

About 2-fluoroethyl 2-(4-phenylphenyl)acetate

2-fluoroethyl 2-(4-phenylphenyl)acetate (PubChem CID 20288) has the molecular formula C16H15FO2 and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-fluoroethyl 2-(4-phenylphenyl)acetate.

Molecular Properties

Compound Name2-fluoroethyl 2-(4-phenylphenyl)acetate
PubChem CID20288
Molecular FormulaC16H15FO2
Molecular Weight258.29 g/mol
Exact Mass258.11
IUPAC Name2-fluoroethyl 2-(4-phenylphenyl)acetate
SMILESO=C(Cc1ccc(-c2ccccc2)cc1)OCCF
InChIInChI=1S/C16H15FO2/c17-10-11-19-16(18)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9H,10-12H2
InChIKeyXAERLJMOUYEBAB-UHFFFAOYSA-N
XLogP3.41
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.29
LogP ≤ 53.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-fluoroethyl 2-(4-phenylphenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoroethyl 2-(4-phenylphenyl)acetate?
The IUPAC name of 2-fluoroethyl 2-(4-phenylphenyl)acetate (CID 20288) is 2-fluoroethyl 2-(4-phenylphenyl)acetate.
What is the SMILES notation for 2-fluoroethyl 2-(4-phenylphenyl)acetate?
The canonical SMILES for 2-fluoroethyl 2-(4-phenylphenyl)acetate is O=C(Cc1ccc(-c2ccccc2)cc1)OCCF.
What is the InChIKey of 2-fluoroethyl 2-(4-phenylphenyl)acetate?
The InChIKey is XAERLJMOUYEBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FO2/c17-10-11-19-16(18)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9H,10-12H2.
What are the key properties of 2-fluoroethyl 2-(4-phenylphenyl)acetate?
2-fluoroethyl 2-(4-phenylphenyl)acetate has a molecular weight of 258.29 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 2-(4-phenylphenyl)acetate is sourced from PubChem (CID 20288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).