About 5-oxohexyl acetate
5-oxohexyl acetate (PubChem CID 20296) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 5-oxohexyl acetate.
Molecular Properties
| Compound Name | 5-oxohexyl acetate |
| PubChem CID | 20296 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 5-oxohexyl acetate |
| SMILES | CC(=O)CCCCOC(C)=O |
| InChI | InChI=1S/C8H14O3/c1-7(9)5-3-4-6-11-8(2)10/h3-6H2,1-2H3 |
| InChIKey | MXAYALRYWBJGFI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-oxohexyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxohexyl acetate?
The IUPAC name of 5-oxohexyl acetate (CID 20296) is 5-oxohexyl acetate.
What is the SMILES notation for 5-oxohexyl acetate?
The canonical SMILES for 5-oxohexyl acetate is CC(=O)CCCCOC(C)=O.
What is the InChIKey of 5-oxohexyl acetate?
The InChIKey is MXAYALRYWBJGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-7(9)5-3-4-6-11-8(2)10/h3-6H2,1-2H3.
What are the key properties of 5-oxohexyl acetate?
5-oxohexyl acetate has a molecular weight of 158.20 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxohexyl acetate is sourced from PubChem (CID 20296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).