C12H24N6S2 — CID 2029944
5-propyl-1-(5-propyl-2-sulfanylidene-1,3,5-triazinan-1-yl)-1,3,5-triazinane-2-thione (PubChem CID 2029944) has the molecular formula C12H24N6S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 5-propyl-1-(5-propyl-2-sulfanylidene-1,3,5-triazinan-1-yl)-1,3,5-triazinane-2-thione.
| Compound Name | 5-propyl-1-(5-propyl-2-sulfanylidene-1,3,5-triazinan-1-yl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 2029944 |
| Molecular Formula | C12H24N6S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-propyl-1-(5-propyl-2-sulfanylidene-1,3,5-triazinan-1-yl)-1,3,5-triazinane-2-thione |
| SMILES | CCCN1CNC(=S)N(N2CN(CCC)CNC2=S)C1 |
| InChI | InChI=1S/C12H24N6S2/c1-3-5-15-7-13-11(19)17(9-15)18-10-16(6-4-2)8-14-12(18)20/h3-10H2,1-2H3,(H,13,19)(H,14,20) |
| InChIKey | SQGQLVYFPILBTQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 37.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|