C24H23Cl2N7O — CID 2030568
1-(3,4-dichlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]urea (PubChem CID 2030568) has the molecular formula C24H23Cl2N7O and a molecular weight of 496.40 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 2030568 |
| Molecular Formula | C24H23Cl2N7O |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[N-(4,6-dimethylpyrimidin-2-yl)-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(N/C(=N/CCc2c[nH]c3ccccc23)NC(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C24H23Cl2N7O/c1-14-11-15(2)30-23(29-14)32-22(33-24(34)31-17-7-8-19(25)20(26)12-17)27-10-9-16-13-28-21-6-4-3-5-18(16)21/h3-8,11-13,28H,9-10H2,1-2H3,(H3,27,29,30,31,32,33,34) |
| InChIKey | UWKOCCKCVRXQLY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|