4-methylphthalic acid

C9H8O4 — CID 20310

IUPAC4-methylphthalic acid
SMILESCc1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C9H8O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)
InChIKeyCWJJAFQCTXFSTA-UHFFFAOYSA-N
MW180.16 g/mol
LogP1.39
Rot. Bonds2

About 4-methylphthalic acid

4-methylphthalic acid (PubChem CID 20310) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 4-methylphthalic acid.

Molecular Properties

Compound Name4-methylphthalic acid
PubChem CID20310
Molecular FormulaC9H8O4
Molecular Weight180.16 g/mol
Exact Mass180.04
IUPAC Name4-methylphthalic acid
SMILESCc1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C9H8O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13)
InChIKeyCWJJAFQCTXFSTA-UHFFFAOYSA-N
XLogP1.39
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.16
LogP ≤ 51.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-methylphthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylphthalic acid?
The IUPAC name of 4-methylphthalic acid (CID 20310) is 4-methylphthalic acid.
What is the SMILES notation for 4-methylphthalic acid?
The canonical SMILES for 4-methylphthalic acid is Cc1ccc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 4-methylphthalic acid?
The InChIKey is CWJJAFQCTXFSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13).
What are the key properties of 4-methylphthalic acid?
4-methylphthalic acid has a molecular weight of 180.16 g/mol, XLogP of 1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylphthalic acid is sourced from PubChem (CID 20310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).