C13H18N2O3S — CID 2031105
(2S)-2-[(2-methylphenyl)carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 2031105) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is (2S)-2-[(2-methylphenyl)carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[(2-methylphenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 2031105 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (2S)-2-[(2-methylphenyl)carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)Nc1ccccc1C)C(=O)O |
| InChI | InChI=1S/C13H18N2O3S/c1-9-5-3-4-6-10(9)14-13(18)15-11(12(16)17)7-8-19-2/h3-6,11H,7-8H2,1-2H3,(H,16,17)(H2,14,15,18)/t11-/m0/s1 |
| InChIKey | DXQDPAZRJZBRHV-NSHDSACASA-N |
| XLogP | 2.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |