About ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate
ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate (PubChem CID 2032588) has the molecular formula C17H25N5O3
and a molecular weight of 347.42 g/mol. Its IUPAC name is ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate |
| PubChem CID | 2032588 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2=NC3(CCCCC3)[C@H](C#N)C(=O)N2)CC1 |
| InChI | InChI=1S/C17H25N5O3/c1-2-25-16(24)22-10-8-21(9-11-22)15-19-14(23)13(12-18)17(20-15)6-4-3-5-7-17/h13H,2-11H2,1H3,(H,19,20,23)/t13-/m1/s1 |
| InChIKey | YCSGPFXRXUIHRO-CYBMUJFWSA-N |
| XLogP | 1.09 |
| TPSA | 98.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate (CID 2032588) is ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C2=NC3(CCCCC3)[C@H](C#N)C(=O)N2)CC1.
What is the InChIKey of ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate?
The InChIKey is YCSGPFXRXUIHRO-CYBMUJFWSA-N. The full InChI is InChI=1S/C17H25N5O3/c1-2-25-16(24)22-10-8-21(9-11-22)15-19-14(23)13(12-18)17(20-15)6-4-3-5-7-17/h13H,2-11H2,1H3,(H,19,20,23)/t13-/m1/s1.
What are the key properties of ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate?
ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate has a molecular weight of 347.42 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(5R)-5-cyano-4-oxo-1,3-diazaspiro[5.5]undec-1-en-2-yl]piperazine-1-carboxylate is sourced from PubChem (CID 2032588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).